C15H12Cl2N2O2 — CID 162395253
(E)-3-(3,4-dichlorophenyl)-N-(6-methoxy-3-pyridinyl)prop-2-enamide (PubChem CID 162395253) has the molecular formula C15H12Cl2N2O2 and a molecular weight of 323.18 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-N-(6-methoxy-3-pyridinyl)prop-2-enamide.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-N-(6-methoxy-3-pyridinyl)prop-2-enamide |
|---|---|
| PubChem CID | 162395253 |
| Molecular Formula | C15H12Cl2N2O2 |
| Molecular Weight | 323.18 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-N-(6-methoxy-3-pyridinyl)prop-2-enamide |
| SMILES | COc1ccc(NC(=O)/C=C/c2ccc(Cl)c(Cl)c2)cn1 |
| InChI | InChI=1S/C15H12Cl2N2O2/c1-21-15-7-4-11(9-18-15)19-14(20)6-3-10-2-5-12(16)13(17)8-10/h2-9H,1H3,(H,19,20)/b6-3+ |
| InChIKey | JXTPVIFLGISICA-ZZXKWVIFSA-N |
| XLogP | 4.05 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.18 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|