C19H23N3O4S — CID 7550836
(E)-3-[4-(diethylsulfamoyl)phenyl]-N-(6-methoxy-3-pyridinyl)prop-2-enamide (PubChem CID 7550836) has the molecular formula C19H23N3O4S and a molecular weight of 389.48 g/mol. Its IUPAC name is (E)-3-[4-(diethylsulfamoyl)phenyl]-N-(6-methoxy-3-pyridinyl)prop-2-enamide.
| Compound Name | (E)-3-[4-(diethylsulfamoyl)phenyl]-N-(6-methoxy-3-pyridinyl)prop-2-enamide |
|---|---|
| PubChem CID | 7550836 |
| Molecular Formula | C19H23N3O4S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | (E)-3-[4-(diethylsulfamoyl)phenyl]-N-(6-methoxy-3-pyridinyl)prop-2-enamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(/C=C/C(=O)Nc2ccc(OC)nc2)cc1 |
| InChI | InChI=1S/C19H23N3O4S/c1-4-22(5-2)27(24,25)17-10-6-15(7-11-17)8-12-18(23)21-16-9-13-19(26-3)20-14-16/h6-14H,4-5H2,1-3H3,(H,21,23)/b12-8+ |
| InChIKey | YGETZCVWAOJPQW-XYOKQWHBSA-N |
| XLogP | 2.77 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|