C22H23N3O4S — CID 78890114
(E)-3-[4-(diethylsulfamoyl)phenyl]-N-[4-(1,3-oxazol-5-yl)phenyl]prop-2-enamide (PubChem CID 78890114) has the molecular formula C22H23N3O4S and a molecular weight of 425.51 g/mol. Its IUPAC name is (E)-3-[4-(diethylsulfamoyl)phenyl]-N-[4-(1,3-oxazol-5-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-[4-(diethylsulfamoyl)phenyl]-N-[4-(1,3-oxazol-5-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 78890114 |
| Molecular Formula | C22H23N3O4S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | (E)-3-[4-(diethylsulfamoyl)phenyl]-N-[4-(1,3-oxazol-5-yl)phenyl]prop-2-enamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(/C=C/C(=O)Nc2ccc(-c3cnco3)cc2)cc1 |
| InChI | InChI=1S/C22H23N3O4S/c1-3-25(4-2)30(27,28)20-12-5-17(6-13-20)7-14-22(26)24-19-10-8-18(9-11-19)21-15-23-16-29-21/h5-16H,3-4H2,1-2H3,(H,24,26)/b14-7+ |
| InChIKey | KYLZXWZASWGFID-VGOFMYFVSA-N |
| XLogP | 4.02 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|