C17H13N3O2 — CID 103598249
N-[4-(1,3-oxazol-5-yl)phenyl]-3-pyridin-4-ylprop-2-enamide (PubChem CID 103598249) has the molecular formula C17H13N3O2 and a molecular weight of 291.31 g/mol. Its IUPAC name is N-[4-(1,3-oxazol-5-yl)phenyl]-3-pyridin-4-ylprop-2-enamide.
| Compound Name | N-[4-(1,3-oxazol-5-yl)phenyl]-3-pyridin-4-ylprop-2-enamide |
|---|---|
| PubChem CID | 103598249 |
| Molecular Formula | C17H13N3O2 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | N-[4-(1,3-oxazol-5-yl)phenyl]-3-pyridin-4-ylprop-2-enamide |
| SMILES | O=C(C=Cc1ccncc1)Nc1ccc(-c2cnco2)cc1 |
| InChI | InChI=1S/C17H13N3O2/c21-17(6-1-13-7-9-18-10-8-13)20-15-4-2-14(3-5-15)16-11-19-12-22-16/h1-12H,(H,20,21) |
| InChIKey | RHGWYFAGLMFJPK-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|