C21H18N4O6 — CID 25181996
N-[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-N'-[4-methoxy-3-(1,3-oxazol-5-yl)phenyl]oxamide (PubChem CID 25181996) has the molecular formula C21H18N4O6 and a molecular weight of 422.40 g/mol. Its IUPAC name is N-[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-N'-[4-methoxy-3-(1,3-oxazol-5-yl)phenyl]oxamide.
| Compound Name | N-[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-N'-[4-methoxy-3-(1,3-oxazol-5-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 25181996 |
| Molecular Formula | C21H18N4O6 |
| Molecular Weight | 422.40 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | N-[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-N'-[4-methoxy-3-(1,3-oxazol-5-yl)phenyl]oxamide |
| SMILES | COc1ccc(NC(=O)C(=O)Nc2ccc(/C=C/C(=O)NO)cc2)cc1-c1cnco1 |
| InChI | InChI=1S/C21H18N4O6/c1-30-17-8-7-15(10-16(17)18-11-22-12-31-18)24-21(28)20(27)23-14-5-2-13(3-6-14)4-9-19(26)25-29/h2-12,29H,1H3,(H,23,27)(H,24,28)(H,25,26)/b9-4+ |
| InChIKey | VROGJPDHTOEDJG-RUDMXATFSA-N |
| XLogP | 2.45 |
| TPSA | 142.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|