C22H22N2O4 — CID 78890153
(E)-3-(3,4-diethoxyphenyl)-N-[4-(1,3-oxazol-5-yl)phenyl]prop-2-enamide (PubChem CID 78890153) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is (E)-3-(3,4-diethoxyphenyl)-N-[4-(1,3-oxazol-5-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-diethoxyphenyl)-N-[4-(1,3-oxazol-5-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 78890153 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | (E)-3-(3,4-diethoxyphenyl)-N-[4-(1,3-oxazol-5-yl)phenyl]prop-2-enamide |
| SMILES | CCOc1ccc(/C=C/C(=O)Nc2ccc(-c3cnco3)cc2)cc1OCC |
| InChI | InChI=1S/C22H22N2O4/c1-3-26-19-11-5-16(13-20(19)27-4-2)6-12-22(25)24-18-9-7-17(8-10-18)21-14-23-15-28-21/h5-15H,3-4H2,1-2H3,(H,24,25)/b12-6+ |
| InChIKey | QPWHZVQZYPQHKH-WUXMJOGZSA-N |
| XLogP | 4.79 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|