C27H24N2O5 — CID 67047065
N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enamide (PubChem CID 67047065) has the molecular formula C27H24N2O5 and a molecular weight of 456.50 g/mol. Its IUPAC name is N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enamide.
| Compound Name | N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 67047065 |
| Molecular Formula | C27H24N2O5 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(C=CC(=O)Nc2ccc(-c3cnco3)c(OC)c2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C27H24N2O5/c1-31-24-15-21(10-11-22(24)26-16-28-18-34-26)29-27(30)13-9-19-8-12-23(25(14-19)32-2)33-17-20-6-4-3-5-7-20/h3-16,18H,17H2,1-2H3,(H,29,30) |
| InChIKey | QEIWXFPMJKKPNZ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 82.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|