C19H17N3O4 — CID 10338010
N'-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N-phenylpropanediamide (PubChem CID 10338010) has the molecular formula C19H17N3O4 and a molecular weight of 351.36 g/mol. Its IUPAC name is N'-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N-phenylpropanediamide.
| Compound Name | N'-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N-phenylpropanediamide |
|---|---|
| PubChem CID | 10338010 |
| Molecular Formula | C19H17N3O4 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | N'-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N-phenylpropanediamide |
| SMILES | COc1cc(NC(=O)CC(=O)Nc2ccccc2)ccc1-c1cnco1 |
| InChI | InChI=1S/C19H17N3O4/c1-25-16-9-14(7-8-15(16)17-11-20-12-26-17)22-19(24)10-18(23)21-13-5-3-2-4-6-13/h2-9,11-12H,10H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | UKWZOWCEYYIFMH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|