C21H19F3N4O6 — CID 22558403
N'-[3-(aminomethyl)phenyl]-N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]oxamide;2,2,2-trifluoroacetic acid (PubChem CID 22558403) has the molecular formula C21H19F3N4O6 and a molecular weight of 480.40 g/mol. Its IUPAC name is N'-[3-(aminomethyl)phenyl]-N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]oxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N'-[3-(aminomethyl)phenyl]-N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]oxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 22558403 |
| Molecular Formula | C21H19F3N4O6 |
| Molecular Weight | 480.40 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | N'-[3-(aminomethyl)phenyl]-N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]oxamide;2,2,2-trifluoroacetic acid |
| SMILES | COc1cc(NC(=O)C(=O)Nc2cccc(CN)c2)ccc1-c1cnco1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H18N4O4.C2HF3O2/c1-26-16-8-14(5-6-15(16)17-10-21-11-27-17)23-19(25)18(24)22-13-4-2-3-12(7-13)9-20;3-2(4,5)1(6)7/h2-8,10-11H,9,20H2,1H3,(H,22,24)(H,23,25);(H,6,7) |
| InChIKey | FPOZTQGIKPYFBR-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 156.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.40 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|