C23H25N3O4 — CID 10179570
N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N'-[2-methyl-1-(3-methylphenyl)propan-2-yl]oxamide (PubChem CID 10179570) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N'-[2-methyl-1-(3-methylphenyl)propan-2-yl]oxamide.
| Compound Name | N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N'-[2-methyl-1-(3-methylphenyl)propan-2-yl]oxamide |
|---|---|
| PubChem CID | 10179570 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N'-[2-methyl-1-(3-methylphenyl)propan-2-yl]oxamide |
| SMILES | COc1cc(NC(=O)C(=O)NC(C)(C)Cc2cccc(C)c2)ccc1-c1cnco1 |
| InChI | InChI=1S/C23H25N3O4/c1-15-6-5-7-16(10-15)12-23(2,3)26-22(28)21(27)25-17-8-9-18(19(11-17)29-4)20-13-24-14-30-20/h5-11,13-14H,12H2,1-4H3,(H,25,27)(H,26,28) |
| InChIKey | LUEZKCNECFSWFG-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|