C31H32N4O7 — CID 20766678
N'-[1-[4-[(3,4-dimethoxybenzoyl)amino]phenyl]-2-methylpropan-2-yl]-N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]oxamide (PubChem CID 20766678) has the molecular formula C31H32N4O7 and a molecular weight of 572.62 g/mol. Its IUPAC name is N'-[1-[4-[(3,4-dimethoxybenzoyl)amino]phenyl]-2-methylpropan-2-yl]-N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]oxamide.
| Compound Name | N'-[1-[4-[(3,4-dimethoxybenzoyl)amino]phenyl]-2-methylpropan-2-yl]-N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 20766678 |
| Molecular Formula | C31H32N4O7 |
| Molecular Weight | 572.62 g/mol |
| Exact Mass | 572.23 |
| IUPAC Name | N'-[1-[4-[(3,4-dimethoxybenzoyl)amino]phenyl]-2-methylpropan-2-yl]-N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]oxamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(CC(C)(C)NC(=O)C(=O)Nc3ccc(-c4cnco4)c(OC)c3)cc2)cc1OC |
| InChI | InChI=1S/C31H32N4O7/c1-31(2,35-30(38)29(37)34-22-11-12-23(25(15-22)40-4)27-17-32-18-42-27)16-19-6-9-21(10-7-19)33-28(36)20-8-13-24(39-3)26(14-20)41-5/h6-15,17-18H,16H2,1-5H3,(H,33,36)(H,34,37)(H,35,38) |
| InChIKey | ZAZFGDKTJPEZGR-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 141.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.62 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|