C22H24N4O6 — CID 20766511
N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N'-[2-methyl-1-[(2-methylfuran-3-carbonyl)amino]propan-2-yl]oxamide (PubChem CID 20766511) has the molecular formula C22H24N4O6 and a molecular weight of 440.46 g/mol. Its IUPAC name is N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N'-[2-methyl-1-[(2-methylfuran-3-carbonyl)amino]propan-2-yl]oxamide.
| Compound Name | N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N'-[2-methyl-1-[(2-methylfuran-3-carbonyl)amino]propan-2-yl]oxamide |
|---|---|
| PubChem CID | 20766511 |
| Molecular Formula | C22H24N4O6 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N'-[2-methyl-1-[(2-methylfuran-3-carbonyl)amino]propan-2-yl]oxamide |
| SMILES | COc1cc(NC(=O)C(=O)NC(C)(C)CNC(=O)c2ccoc2C)ccc1-c1cnco1 |
| InChI | InChI=1S/C22H24N4O6/c1-13-15(7-8-31-13)19(27)24-11-22(2,3)26-21(29)20(28)25-14-5-6-16(17(9-14)30-4)18-10-23-12-32-18/h5-10,12H,11H2,1-4H3,(H,24,27)(H,25,28)(H,26,29) |
| InChIKey | FJCZOILCTIRLRO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 135.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|