C27H26N4O5 — CID 20766557
N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N'-[2-methyl-1-(naphthalene-1-carbonylamino)propan-2-yl]oxamide (PubChem CID 20766557) has the molecular formula C27H26N4O5 and a molecular weight of 486.53 g/mol. Its IUPAC name is N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N'-[2-methyl-1-(naphthalene-1-carbonylamino)propan-2-yl]oxamide.
| Compound Name | N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N'-[2-methyl-1-(naphthalene-1-carbonylamino)propan-2-yl]oxamide |
|---|---|
| PubChem CID | 20766557 |
| Molecular Formula | C27H26N4O5 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N'-[2-methyl-1-(naphthalene-1-carbonylamino)propan-2-yl]oxamide |
| SMILES | COc1cc(NC(=O)C(=O)NC(C)(C)CNC(=O)c2cccc3ccccc23)ccc1-c1cnco1 |
| InChI | InChI=1S/C27H26N4O5/c1-27(2,15-29-24(32)20-10-6-8-17-7-4-5-9-19(17)20)31-26(34)25(33)30-18-11-12-21(22(13-18)35-3)23-14-28-16-36-23/h4-14,16H,15H2,1-3H3,(H,29,32)(H,30,33)(H,31,34) |
| InChIKey | CHDANBAQQSFYAA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 122.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|