C25H28N4O6 — CID 20766774
N'-[4-(3-acetamidophenoxy)-2-methylbutan-2-yl]-N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]oxamide (PubChem CID 20766774) has the molecular formula C25H28N4O6 and a molecular weight of 480.52 g/mol. Its IUPAC name is N'-[4-(3-acetamidophenoxy)-2-methylbutan-2-yl]-N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]oxamide.
| Compound Name | N'-[4-(3-acetamidophenoxy)-2-methylbutan-2-yl]-N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 20766774 |
| Molecular Formula | C25H28N4O6 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | N'-[4-(3-acetamidophenoxy)-2-methylbutan-2-yl]-N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]oxamide |
| SMILES | COc1cc(NC(=O)C(=O)NC(C)(C)CCOc2cccc(NC(C)=O)c2)ccc1-c1cnco1 |
| InChI | InChI=1S/C25H28N4O6/c1-16(30)27-17-6-5-7-19(12-17)34-11-10-25(2,3)29-24(32)23(31)28-18-8-9-20(21(13-18)33-4)22-14-26-15-35-22/h5-9,12-15H,10-11H2,1-4H3,(H,27,30)(H,28,31)(H,29,32) |
| InChIKey | HUWBSNCMQOKUHR-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 131.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|