C25H26N4O6 — CID 20766796
N'-[4-(4-cyano-2-methoxyphenoxy)-2-methylbutan-2-yl]-N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]oxamide (PubChem CID 20766796) has the molecular formula C25H26N4O6 and a molecular weight of 478.51 g/mol. Its IUPAC name is N'-[4-(4-cyano-2-methoxyphenoxy)-2-methylbutan-2-yl]-N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]oxamide.
| Compound Name | N'-[4-(4-cyano-2-methoxyphenoxy)-2-methylbutan-2-yl]-N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 20766796 |
| Molecular Formula | C25H26N4O6 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | N'-[4-(4-cyano-2-methoxyphenoxy)-2-methylbutan-2-yl]-N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]oxamide |
| SMILES | COc1cc(C#N)ccc1OCCC(C)(C)NC(=O)C(=O)Nc1ccc(-c2cnco2)c(OC)c1 |
| InChI | InChI=1S/C25H26N4O6/c1-25(2,9-10-34-19-8-5-16(13-26)11-21(19)33-4)29-24(31)23(30)28-17-6-7-18(20(12-17)32-3)22-14-27-15-35-22/h5-8,11-12,14-15H,9-10H2,1-4H3,(H,28,30)(H,29,31) |
| InChIKey | LHNNVJRWLJSRIX-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 135.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|