C28H35N5O6 — CID 22558449
N'-[1-[4-(3,4-dimethoxyphenyl)piperazin-1-yl]-2-methylpropan-2-yl]-N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]oxamide (PubChem CID 22558449) has the molecular formula C28H35N5O6 and a molecular weight of 537.62 g/mol. Its IUPAC name is N'-[1-[4-(3,4-dimethoxyphenyl)piperazin-1-yl]-2-methylpropan-2-yl]-N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]oxamide.
| Compound Name | N'-[1-[4-(3,4-dimethoxyphenyl)piperazin-1-yl]-2-methylpropan-2-yl]-N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 22558449 |
| Molecular Formula | C28H35N5O6 |
| Molecular Weight | 537.62 g/mol |
| Exact Mass | 537.26 |
| IUPAC Name | N'-[1-[4-(3,4-dimethoxyphenyl)piperazin-1-yl]-2-methylpropan-2-yl]-N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]oxamide |
| SMILES | COc1ccc(N2CCN(CC(C)(C)NC(=O)C(=O)Nc3ccc(-c4cnco4)c(OC)c3)CC2)cc1OC |
| InChI | InChI=1S/C28H35N5O6/c1-28(2,17-32-10-12-33(13-11-32)20-7-9-22(36-3)24(15-20)38-5)31-27(35)26(34)30-19-6-8-21(23(14-19)37-4)25-16-29-18-39-25/h6-9,14-16,18H,10-13,17H2,1-5H3,(H,30,34)(H,31,35) |
| InChIKey | CLTZXVFPQOUNQM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 118.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.62 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|