C26H30FN5O4 — CID 20766694
N'-[1-[4-(4-fluorophenyl)piperazin-1-yl]-2-methylpropan-2-yl]-N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]oxamide (PubChem CID 20766694) has the molecular formula C26H30FN5O4 and a molecular weight of 495.56 g/mol. Its IUPAC name is N'-[1-[4-(4-fluorophenyl)piperazin-1-yl]-2-methylpropan-2-yl]-N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]oxamide.
| Compound Name | N'-[1-[4-(4-fluorophenyl)piperazin-1-yl]-2-methylpropan-2-yl]-N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 20766694 |
| Molecular Formula | C26H30FN5O4 |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | N'-[1-[4-(4-fluorophenyl)piperazin-1-yl]-2-methylpropan-2-yl]-N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]oxamide |
| SMILES | COc1cc(NC(=O)C(=O)NC(C)(C)CN2CCN(c3ccc(F)cc3)CC2)ccc1-c1cnco1 |
| InChI | InChI=1S/C26H30FN5O4/c1-26(2,16-31-10-12-32(13-11-31)20-7-4-18(27)5-8-20)30-25(34)24(33)29-19-6-9-21(22(14-19)35-3)23-15-28-17-36-23/h4-9,14-15,17H,10-13,16H2,1-3H3,(H,29,33)(H,30,34) |
| InChIKey | JXBOMDYYJMIKRS-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 99.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|