C25H29N5O6 — CID 22558459
N'-[1-[4-(furan-2-carbonyl)piperazin-1-yl]-2-methylpropan-2-yl]-N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]oxamide (PubChem CID 22558459) has the molecular formula C25H29N5O6 and a molecular weight of 495.54 g/mol. Its IUPAC name is N'-[1-[4-(furan-2-carbonyl)piperazin-1-yl]-2-methylpropan-2-yl]-N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]oxamide.
| Compound Name | N'-[1-[4-(furan-2-carbonyl)piperazin-1-yl]-2-methylpropan-2-yl]-N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 22558459 |
| Molecular Formula | C25H29N5O6 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | N'-[1-[4-(furan-2-carbonyl)piperazin-1-yl]-2-methylpropan-2-yl]-N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]oxamide |
| SMILES | COc1cc(NC(=O)C(=O)NC(C)(C)CN2CCN(C(=O)c3ccco3)CC2)ccc1-c1cnco1 |
| InChI | InChI=1S/C25H29N5O6/c1-25(2,15-29-8-10-30(11-9-29)24(33)19-5-4-12-35-19)28-23(32)22(31)27-17-6-7-18(20(13-17)34-3)21-14-26-16-36-21/h4-7,12-14,16H,8-11,15H2,1-3H3,(H,27,31)(H,28,32) |
| InChIKey | PXLIERADQRMRDX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 130.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|