C24H27N3O6 — CID 20766863
N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N'-[4-(3-methoxyphenoxy)-2-methylbutan-2-yl]oxamide (PubChem CID 20766863) has the molecular formula C24H27N3O6 and a molecular weight of 453.50 g/mol. Its IUPAC name is N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N'-[4-(3-methoxyphenoxy)-2-methylbutan-2-yl]oxamide.
| Compound Name | N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N'-[4-(3-methoxyphenoxy)-2-methylbutan-2-yl]oxamide |
|---|---|
| PubChem CID | 20766863 |
| Molecular Formula | C24H27N3O6 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N'-[4-(3-methoxyphenoxy)-2-methylbutan-2-yl]oxamide |
| SMILES | COc1cccc(OCCC(C)(C)NC(=O)C(=O)Nc2ccc(-c3cnco3)c(OC)c2)c1 |
| InChI | InChI=1S/C24H27N3O6/c1-24(2,10-11-32-18-7-5-6-17(13-18)30-3)27-23(29)22(28)26-16-8-9-19(20(12-16)31-4)21-14-25-15-33-21/h5-9,12-15H,10-11H2,1-4H3,(H,26,28)(H,27,29) |
| InChIKey | LXJWGGSDGLCUIU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 111.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|