C24H25N3O7 — CID 20766817
N'-[4-(1,3-benzodioxol-5-yloxy)-2-methylbutan-2-yl]-N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]oxamide (PubChem CID 20766817) has the molecular formula C24H25N3O7 and a molecular weight of 467.48 g/mol. Its IUPAC name is N'-[4-(1,3-benzodioxol-5-yloxy)-2-methylbutan-2-yl]-N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]oxamide.
| Compound Name | N'-[4-(1,3-benzodioxol-5-yloxy)-2-methylbutan-2-yl]-N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 20766817 |
| Molecular Formula | C24H25N3O7 |
| Molecular Weight | 467.48 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | N'-[4-(1,3-benzodioxol-5-yloxy)-2-methylbutan-2-yl]-N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]oxamide |
| SMILES | COc1cc(NC(=O)C(=O)NC(C)(C)CCOc2ccc3c(c2)OCO3)ccc1-c1cnco1 |
| InChI | InChI=1S/C24H25N3O7/c1-24(2,8-9-31-16-5-7-18-20(11-16)34-14-33-18)27-23(29)22(28)26-15-4-6-17(19(10-15)30-3)21-12-25-13-32-21/h4-7,10-13H,8-9,14H2,1-3H3,(H,26,28)(H,27,29) |
| InChIKey | GSTRHKUHRQLKDD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 121.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.48 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|