C26H30N4O6 — CID 20766766
N'-[4-(2-acetamido-5-methylphenoxy)-2-methylbutan-2-yl]-N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]oxamide (PubChem CID 20766766) has the molecular formula C26H30N4O6 and a molecular weight of 494.55 g/mol. Its IUPAC name is N'-[4-(2-acetamido-5-methylphenoxy)-2-methylbutan-2-yl]-N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]oxamide.
| Compound Name | N'-[4-(2-acetamido-5-methylphenoxy)-2-methylbutan-2-yl]-N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 20766766 |
| Molecular Formula | C26H30N4O6 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | N'-[4-(2-acetamido-5-methylphenoxy)-2-methylbutan-2-yl]-N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]oxamide |
| SMILES | COc1cc(NC(=O)C(=O)NC(C)(C)CCOc2cc(C)ccc2NC(C)=O)ccc1-c1cnco1 |
| InChI | InChI=1S/C26H30N4O6/c1-16-6-9-20(28-17(2)31)22(12-16)35-11-10-26(3,4)30-25(33)24(32)29-18-7-8-19(21(13-18)34-5)23-14-27-15-36-23/h6-9,12-15H,10-11H2,1-5H3,(H,28,31)(H,29,32)(H,30,33) |
| InChIKey | OSUZWVVKGWNWSF-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 131.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|