C27H33N5O4 — CID 22558476
N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N'-[2-methyl-1-[4-(4-methylphenyl)piperazin-1-yl]propan-2-yl]oxamide (PubChem CID 22558476) has the molecular formula C27H33N5O4 and a molecular weight of 491.59 g/mol. Its IUPAC name is N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N'-[2-methyl-1-[4-(4-methylphenyl)piperazin-1-yl]propan-2-yl]oxamide.
| Compound Name | N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N'-[2-methyl-1-[4-(4-methylphenyl)piperazin-1-yl]propan-2-yl]oxamide |
|---|---|
| PubChem CID | 22558476 |
| Molecular Formula | C27H33N5O4 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N'-[2-methyl-1-[4-(4-methylphenyl)piperazin-1-yl]propan-2-yl]oxamide |
| SMILES | COc1cc(NC(=O)C(=O)NC(C)(C)CN2CCN(c3ccc(C)cc3)CC2)ccc1-c1cnco1 |
| InChI | InChI=1S/C27H33N5O4/c1-19-5-8-21(9-6-19)32-13-11-31(12-14-32)17-27(2,3)30-26(34)25(33)29-20-7-10-22(23(15-20)35-4)24-16-28-18-36-24/h5-10,15-16,18H,11-14,17H2,1-4H3,(H,29,33)(H,30,34) |
| InChIKey | VPGLBLPEYYARIB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 99.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|