C24H26N4O6 — CID 20766988
tert-butyl N-[[4-[[2-[3-methoxy-4-(1,3-oxazol-5-yl)anilino]-2-oxoacetyl]amino]phenyl]methyl]carbamate (PubChem CID 20766988) has the molecular formula C24H26N4O6 and a molecular weight of 466.49 g/mol. Its IUPAC name is tert-butyl N-[[4-[[2-[3-methoxy-4-(1,3-oxazol-5-yl)anilino]-2-oxoacetyl]amino]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[[2-[3-methoxy-4-(1,3-oxazol-5-yl)anilino]-2-oxoacetyl]amino]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 20766988 |
| Molecular Formula | C24H26N4O6 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | tert-butyl N-[[4-[[2-[3-methoxy-4-(1,3-oxazol-5-yl)anilino]-2-oxoacetyl]amino]phenyl]methyl]carbamate |
| SMILES | COc1cc(NC(=O)C(=O)Nc2ccc(CNC(=O)OC(C)(C)C)cc2)ccc1-c1cnco1 |
| InChI | InChI=1S/C24H26N4O6/c1-24(2,3)34-23(31)26-12-15-5-7-16(8-6-15)27-21(29)22(30)28-17-9-10-18(19(11-17)32-4)20-13-25-14-33-20/h5-11,13-14H,12H2,1-4H3,(H,26,31)(H,27,29)(H,28,30) |
| InChIKey | AVAHZDJBXJOVKL-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 131.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|