C18H17N3O5 — CID 20766904
N'-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N-[(5-methylfuran-2-yl)methyl]oxamide (PubChem CID 20766904) has the molecular formula C18H17N3O5 and a molecular weight of 355.35 g/mol. Its IUPAC name is N'-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N-[(5-methylfuran-2-yl)methyl]oxamide.
| Compound Name | N'-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N-[(5-methylfuran-2-yl)methyl]oxamide |
|---|---|
| PubChem CID | 20766904 |
| Molecular Formula | C18H17N3O5 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | N'-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N-[(5-methylfuran-2-yl)methyl]oxamide |
| SMILES | COc1cc(NC(=O)C(=O)NCc2ccc(C)o2)ccc1-c1cnco1 |
| InChI | InChI=1S/C18H17N3O5/c1-11-3-5-13(26-11)8-20-17(22)18(23)21-12-4-6-14(15(7-12)24-2)16-9-19-10-25-16/h3-7,9-10H,8H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | JMHKFRYSBLRMCU-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 106.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|