C16H17N3O6 — CID 20766594
N-(1,3-dioxolan-2-ylmethyl)-N'-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]oxamide (PubChem CID 20766594) has the molecular formula C16H17N3O6 and a molecular weight of 347.33 g/mol. Its IUPAC name is N-(1,3-dioxolan-2-ylmethyl)-N'-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]oxamide.
| Compound Name | N-(1,3-dioxolan-2-ylmethyl)-N'-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 20766594 |
| Molecular Formula | C16H17N3O6 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | N-(1,3-dioxolan-2-ylmethyl)-N'-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]oxamide |
| SMILES | COc1cc(NC(=O)C(=O)NCC2OCCO2)ccc1-c1cnco1 |
| InChI | InChI=1S/C16H17N3O6/c1-22-12-6-10(2-3-11(12)13-7-17-9-25-13)19-16(21)15(20)18-8-14-23-4-5-24-14/h2-3,6-7,9,14H,4-5,8H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | FGPYXNUPNPMBII-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 111.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|