C17H21N3O4 — CID 20766963
N'-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N-(3-methylbutyl)oxamide (PubChem CID 20766963) has the molecular formula C17H21N3O4 and a molecular weight of 331.37 g/mol. Its IUPAC name is N'-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N-(3-methylbutyl)oxamide.
| Compound Name | N'-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N-(3-methylbutyl)oxamide |
|---|---|
| PubChem CID | 20766963 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | N'-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N-(3-methylbutyl)oxamide |
| SMILES | COc1cc(NC(=O)C(=O)NCCC(C)C)ccc1-c1cnco1 |
| InChI | InChI=1S/C17H21N3O4/c1-11(2)6-7-19-16(21)17(22)20-12-4-5-13(14(8-12)23-3)15-9-18-10-24-15/h4-5,8-11H,6-7H2,1-3H3,(H,19,21)(H,20,22) |
| InChIKey | KTMODMZCYZBKKG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|