C24H24N4O7 — CID 22058490
oxolan-3-yl N-[[3-[[2-[3-methoxy-4-(1,3-oxazol-5-yl)anilino]-2-oxoacetyl]amino]phenyl]methyl]carbamate (PubChem CID 22058490) has the molecular formula C24H24N4O7 and a molecular weight of 480.48 g/mol. Its IUPAC name is oxolan-3-yl N-[[3-[[2-[3-methoxy-4-(1,3-oxazol-5-yl)anilino]-2-oxoacetyl]amino]phenyl]methyl]carbamate.
| Compound Name | oxolan-3-yl N-[[3-[[2-[3-methoxy-4-(1,3-oxazol-5-yl)anilino]-2-oxoacetyl]amino]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 22058490 |
| Molecular Formula | C24H24N4O7 |
| Molecular Weight | 480.48 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | oxolan-3-yl N-[[3-[[2-[3-methoxy-4-(1,3-oxazol-5-yl)anilino]-2-oxoacetyl]amino]phenyl]methyl]carbamate |
| SMILES | COc1cc(NC(=O)C(=O)Nc2cccc(CNC(=O)OC3CCOC3)c2)ccc1-c1cnco1 |
| InChI | InChI=1S/C24H24N4O7/c1-32-20-10-17(5-6-19(20)21-12-25-14-34-21)28-23(30)22(29)27-16-4-2-3-15(9-16)11-26-24(31)35-18-7-8-33-13-18/h2-6,9-10,12,14,18H,7-8,11,13H2,1H3,(H,26,31)(H,27,29)(H,28,30) |
| InChIKey | DCYWYFGRSOLDNK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 141.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|