C24H28N4O6 — CID 89228093
[(3S)-oxolan-3-yl] N-[(2E,4E)-4-[[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]carbamoylamino]-2-methylhepta-2,4,6-trienyl]carbamate (PubChem CID 89228093) has the molecular formula C24H28N4O6 and a molecular weight of 468.51 g/mol. Its IUPAC name is [(3S)-oxolan-3-yl] N-[(2E,4E)-4-[[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]carbamoylamino]-2-methylhepta-2,4,6-trienyl]carbamate.
| Compound Name | [(3S)-oxolan-3-yl] N-[(2E,4E)-4-[[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]carbamoylamino]-2-methylhepta-2,4,6-trienyl]carbamate |
|---|---|
| PubChem CID | 89228093 |
| Molecular Formula | C24H28N4O6 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | [(3S)-oxolan-3-yl] N-[(2E,4E)-4-[[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]carbamoylamino]-2-methylhepta-2,4,6-trienyl]carbamate |
| SMILES | C=C/C=C(\C=C(/C)CNC(=O)O[C@H]1CCOC1)NC(=O)Nc1ccc(-c2cnco2)c(OC)c1 |
| InChI | InChI=1S/C24H28N4O6/c1-4-5-17(10-16(2)12-26-24(30)34-19-8-9-32-14-19)27-23(29)28-18-6-7-20(21(11-18)31-3)22-13-25-15-33-22/h4-7,10-11,13,15,19H,1,8-9,12,14H2,2-3H3,(H,26,30)(H2,27,28,29)/b16-10+,17-5+/t19-/m0/s1 |
| InChIKey | ZKHHHTAXTHCABT-NADDKWCYSA-N |
| XLogP | 4.00 |
| TPSA | 123.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|