C26H22N4O5 — CID 20766427
2-[3-[2-[3-methoxy-4-(1,3-oxazol-5-yl)anilino]oxyethynoxyamino]phenyl]-N-phenylacetamide (PubChem CID 20766427) has the molecular formula C26H22N4O5 and a molecular weight of 470.49 g/mol. Its IUPAC name is 2-[3-[2-[3-methoxy-4-(1,3-oxazol-5-yl)anilino]oxyethynoxyamino]phenyl]-N-phenylacetamide.
| Compound Name | 2-[3-[2-[3-methoxy-4-(1,3-oxazol-5-yl)anilino]oxyethynoxyamino]phenyl]-N-phenylacetamide |
|---|---|
| PubChem CID | 20766427 |
| Molecular Formula | C26H22N4O5 |
| Molecular Weight | 470.49 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | 2-[3-[2-[3-methoxy-4-(1,3-oxazol-5-yl)anilino]oxyethynoxyamino]phenyl]-N-phenylacetamide |
| SMILES | COc1cc(NOC#CONc2cccc(CC(=O)Nc3ccccc3)c2)ccc1-c1cnco1 |
| InChI | InChI=1S/C26H22N4O5/c1-32-24-16-22(10-11-23(24)25-17-27-18-33-25)30-35-13-12-34-29-21-9-5-6-19(14-21)15-26(31)28-20-7-3-2-4-8-20/h2-11,14,16-18,29-30H,15H2,1H3,(H,28,31) |
| InChIKey | HZBRQQJYDNTGNV-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 106.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.49 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|