C20H22N4O5 — CID 142907047
(3-formamidophenyl)methylcarbamic acid;3-methoxy-N-methyl-4-(1,3-oxazol-5-yl)aniline (PubChem CID 142907047) has the molecular formula C20H22N4O5 and a molecular weight of 398.42 g/mol. Its IUPAC name is (3-formamidophenyl)methylcarbamic acid;3-methoxy-N-methyl-4-(1,3-oxazol-5-yl)aniline.
| Compound Name | (3-formamidophenyl)methylcarbamic acid;3-methoxy-N-methyl-4-(1,3-oxazol-5-yl)aniline |
|---|---|
| PubChem CID | 142907047 |
| Molecular Formula | C20H22N4O5 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | (3-formamidophenyl)methylcarbamic acid;3-methoxy-N-methyl-4-(1,3-oxazol-5-yl)aniline |
| SMILES | CNc1ccc(-c2cnco2)c(OC)c1.O=CNc1cccc(CNC(=O)O)c1 |
| InChI | InChI=1S/C11H12N2O2.C9H10N2O3/c1-12-8-3-4-9(10(5-8)14-2)11-6-13-7-15-11;12-6-11-8-3-1-2-7(4-8)5-10-9(13)14/h3-7,12H,1-2H3;1-4,6,10H,5H2,(H,11,12)(H,13,14) |
| InChIKey | GTDPARZJGJCPHB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 125.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|