C18H20N2O3 — CID 90177366
2-cyclohex-2-en-1-yl-N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]acetamide (PubChem CID 90177366) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is 2-cyclohex-2-en-1-yl-N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]acetamide.
| Compound Name | 2-cyclohex-2-en-1-yl-N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 90177366 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 2-cyclohex-2-en-1-yl-N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]acetamide |
| SMILES | COc1cc(NC(=O)CC2C=CCCC2)ccc1-c1cnco1 |
| InChI | InChI=1S/C18H20N2O3/c1-22-16-10-14(7-8-15(16)17-11-19-12-23-17)20-18(21)9-13-5-3-2-4-6-13/h3,5,7-8,10-13H,2,4,6,9H2,1H3,(H,20,21) |
| InChIKey | ABLMSRQBLHDHOL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|