C20H15F3N2O3 — CID 67046910
N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-3-[2-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 67046910) has the molecular formula C20H15F3N2O3 and a molecular weight of 388.35 g/mol. Its IUPAC name is N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-3-[2-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-3-[2-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 67046910 |
| Molecular Formula | C20H15F3N2O3 |
| Molecular Weight | 388.35 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-3-[2-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | COc1cc(NC(=O)C=Cc2ccccc2C(F)(F)F)ccc1-c1cnco1 |
| InChI | InChI=1S/C20H15F3N2O3/c1-27-17-10-14(7-8-15(17)18-11-24-12-28-18)25-19(26)9-6-13-4-2-3-5-16(13)20(21,22)23/h2-12H,1H3,(H,25,26) |
| InChIKey | GNBIWUIYTFUYBH-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.35 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|