3-methoxy-4-(1,3-oxazol-5-yl)benzoic acid

C11H9NO4 — CID 23577995

IUPAC3-methoxy-4-(1,3-oxazol-5-yl)benzoic acid
SMILESCOc1cc(C(=O)O)ccc1-c1cnco1
InChIInChI=1S/C11H9NO4/c1-15-9-4-7(11(13)14)2-3-8(9)10-5-12-6-16-10/h2-6H,1H3,(H,13,14)
InChIKeyITFIALYGOUNASG-UHFFFAOYSA-N
MW219.20 g/mol
LogP2.05
Rot. Bonds3

About 3-methoxy-4-(1,3-oxazol-5-yl)benzoic acid

3-methoxy-4-(1,3-oxazol-5-yl)benzoic acid (PubChem CID 23577995) has the molecular formula C11H9NO4 and a molecular weight of 219.20 g/mol. Its IUPAC name is 3-methoxy-4-(1,3-oxazol-5-yl)benzoic acid.

Molecular Properties

Compound Name3-methoxy-4-(1,3-oxazol-5-yl)benzoic acid
PubChem CID23577995
Molecular FormulaC11H9NO4
Molecular Weight219.20 g/mol
Exact Mass219.05
IUPAC Name3-methoxy-4-(1,3-oxazol-5-yl)benzoic acid
SMILESCOc1cc(C(=O)O)ccc1-c1cnco1
InChIInChI=1S/C11H9NO4/c1-15-9-4-7(11(13)14)2-3-8(9)10-5-12-6-16-10/h2-6H,1H3,(H,13,14)
InChIKeyITFIALYGOUNASG-UHFFFAOYSA-N
XLogP2.05
TPSA72.56 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500219.20
LogP ≤ 52.05
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-methoxy-4-(1,3-oxazol-5-yl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-methoxy-4-(1,3-oxazol-5-yl)benzoic acid?
The IUPAC name of 3-methoxy-4-(1,3-oxazol-5-yl)benzoic acid (CID 23577995) is 3-methoxy-4-(1,3-oxazol-5-yl)benzoic acid.
What is the SMILES notation for 3-methoxy-4-(1,3-oxazol-5-yl)benzoic acid?
The canonical SMILES for 3-methoxy-4-(1,3-oxazol-5-yl)benzoic acid is COc1cc(C(=O)O)ccc1-c1cnco1.
What is the InChIKey of 3-methoxy-4-(1,3-oxazol-5-yl)benzoic acid?
The InChIKey is ITFIALYGOUNASG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO4/c1-15-9-4-7(11(13)14)2-3-8(9)10-5-12-6-16-10/h2-6H,1H3,(H,13,14).
What are the key properties of 3-methoxy-4-(1,3-oxazol-5-yl)benzoic acid?
3-methoxy-4-(1,3-oxazol-5-yl)benzoic acid has a molecular weight of 219.20 g/mol, XLogP of 2.05, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-4-(1,3-oxazol-5-yl)benzoic acid is sourced from PubChem (CID 23577995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).