C13H17NO2 — CID 143041662
ethane;5-(2-methoxy-4-methylphenyl)-1,3-oxazole (PubChem CID 143041662) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is ethane;5-(2-methoxy-4-methylphenyl)-1,3-oxazole.
| Compound Name | ethane;5-(2-methoxy-4-methylphenyl)-1,3-oxazole |
|---|---|
| PubChem CID | 143041662 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | ethane;5-(2-methoxy-4-methylphenyl)-1,3-oxazole |
| SMILES | CC.COc1cc(C)ccc1-c1cnco1 |
| InChI | InChI=1S/C11H11NO2.C2H6/c1-8-3-4-9(10(5-8)13-2)11-6-12-7-14-11;1-2/h3-7H,1-2H3;1-2H3 |
| InChIKey | RAXLSFUPWRDJCO-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |