C10H9NO2 — CID 123933373
5-methyl-2-(1,3-oxazol-5-yl)phenol (PubChem CID 123933373) has the molecular formula C10H9NO2 and a molecular weight of 175.19 g/mol. Its IUPAC name is 5-methyl-2-(1,3-oxazol-5-yl)phenol.
| Compound Name | 5-methyl-2-(1,3-oxazol-5-yl)phenol |
|---|---|
| PubChem CID | 123933373 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 5-methyl-2-(1,3-oxazol-5-yl)phenol |
| SMILES | Cc1ccc(-c2cnco2)c(O)c1 |
| InChI | InChI=1S/C10H9NO2/c1-7-2-3-8(9(12)4-7)10-5-11-6-13-10/h2-6,12H,1H3 |
| InChIKey | AFMMWRQFOQXQCG-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |