C19H17N3O2 — CID 159378893
5-(4-methylphenyl)-1,3-oxazole;4-(1,3-oxazol-5-yl)aniline (PubChem CID 159378893) has the molecular formula C19H17N3O2 and a molecular weight of 319.36 g/mol. Its IUPAC name is 5-(4-methylphenyl)-1,3-oxazole;4-(1,3-oxazol-5-yl)aniline.
| Compound Name | 5-(4-methylphenyl)-1,3-oxazole;4-(1,3-oxazol-5-yl)aniline |
|---|---|
| PubChem CID | 159378893 |
| Molecular Formula | C19H17N3O2 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 5-(4-methylphenyl)-1,3-oxazole;4-(1,3-oxazol-5-yl)aniline |
| SMILES | Cc1ccc(-c2cnco2)cc1.Nc1ccc(-c2cnco2)cc1 |
| InChI | InChI=1S/C10H9NO.C9H8N2O/c1-8-2-4-9(5-3-8)10-6-11-7-12-10;10-8-3-1-7(2-4-8)9-5-11-6-12-9/h2-7H,1H3;1-6H,10H2 |
| InChIKey | LKQUAOUUFJFSKP-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 78.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|