About benzene;5-phenyl-1,3-oxazole
benzene;5-phenyl-1,3-oxazole (PubChem CID 69095044) has the molecular formula C15H13NO
and a molecular weight of 223.28 g/mol. Its IUPAC name is benzene;5-phenyl-1,3-oxazole.
Molecular Properties
| Compound Name | benzene;5-phenyl-1,3-oxazole |
| PubChem CID | 69095044 |
| Molecular Formula | C15H13NO |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | benzene;5-phenyl-1,3-oxazole |
| SMILES | c1ccc(-c2cnco2)cc1.c1ccccc1 |
| InChI | InChI=1S/C9H7NO.C6H6/c1-2-4-8(5-3-1)9-6-10-7-11-9;1-2-4-6-5-3-1/h1-7H;1-6H |
| InChIKey | FWRYJPKDVHMSTR-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzene;5-phenyl-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;5-phenyl-1,3-oxazole?
The IUPAC name of benzene;5-phenyl-1,3-oxazole (CID 69095044) is benzene;5-phenyl-1,3-oxazole.
What is the SMILES notation for benzene;5-phenyl-1,3-oxazole?
The canonical SMILES for benzene;5-phenyl-1,3-oxazole is c1ccc(-c2cnco2)cc1.c1ccccc1.
What is the InChIKey of benzene;5-phenyl-1,3-oxazole?
The InChIKey is FWRYJPKDVHMSTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO.C6H6/c1-2-4-8(5-3-1)9-6-10-7-11-9;1-2-4-6-5-3-1/h1-7H;1-6H.
What are the key properties of benzene;5-phenyl-1,3-oxazole?
benzene;5-phenyl-1,3-oxazole has a molecular weight of 223.28 g/mol, XLogP of 4.03, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;5-phenyl-1,3-oxazole is sourced from PubChem (CID 69095044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).