About [3-(1,3-oxazol-5-yl)phenyl]methanol
[3-(1,3-oxazol-5-yl)phenyl]methanol (PubChem CID 54312387) has the molecular formula C10H9NO2
and a molecular weight of 175.19 g/mol. Its IUPAC name is [3-(1,3-oxazol-5-yl)phenyl]methanol.
Molecular Properties
| Compound Name | [3-(1,3-oxazol-5-yl)phenyl]methanol |
| PubChem CID | 54312387 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | [3-(1,3-oxazol-5-yl)phenyl]methanol |
| SMILES | OCc1cccc(-c2cnco2)c1 |
| InChI | InChI=1S/C10H9NO2/c12-6-8-2-1-3-9(4-8)10-5-11-7-13-10/h1-5,7,12H,6H2 |
| InChIKey | SLUPJDRQKXNVAI-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-(1,3-oxazol-5-yl)phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(1,3-oxazol-5-yl)phenyl]methanol?
The IUPAC name of [3-(1,3-oxazol-5-yl)phenyl]methanol (CID 54312387) is [3-(1,3-oxazol-5-yl)phenyl]methanol.
What is the SMILES notation for [3-(1,3-oxazol-5-yl)phenyl]methanol?
The canonical SMILES for [3-(1,3-oxazol-5-yl)phenyl]methanol is OCc1cccc(-c2cnco2)c1.
What is the InChIKey of [3-(1,3-oxazol-5-yl)phenyl]methanol?
The InChIKey is SLUPJDRQKXNVAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO2/c12-6-8-2-1-3-9(4-8)10-5-11-7-13-10/h1-5,7,12H,6H2.
What are the key properties of [3-(1,3-oxazol-5-yl)phenyl]methanol?
[3-(1,3-oxazol-5-yl)phenyl]methanol has a molecular weight of 175.19 g/mol, XLogP of 1.83, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(1,3-oxazol-5-yl)phenyl]methanol is sourced from PubChem (CID 54312387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).