C11H11NO2 — CID 55266243
2-[4-(1,3-oxazol-5-yl)phenyl]ethanol (PubChem CID 55266243) has the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. Its IUPAC name is 2-[4-(1,3-oxazol-5-yl)phenyl]ethanol.
| Compound Name | 2-[4-(1,3-oxazol-5-yl)phenyl]ethanol |
|---|---|
| PubChem CID | 55266243 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 2-[4-(1,3-oxazol-5-yl)phenyl]ethanol |
| SMILES | OCCc1ccc(-c2cnco2)cc1 |
| InChI | InChI=1S/C11H11NO2/c13-6-5-9-1-3-10(4-2-9)11-7-12-8-14-11/h1-4,7-8,13H,5-6H2 |
| InChIKey | LMLXCQSGIUMHHK-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |