C12H11NO4 — CID 115111153
5-[4-(2-hydroxyethyl)phenyl]-1,2-oxazole-3-carboxylic acid (PubChem CID 115111153) has the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. Its IUPAC name is 5-[4-(2-hydroxyethyl)phenyl]-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-[4-(2-hydroxyethyl)phenyl]-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 115111153 |
| Molecular Formula | C12H11NO4 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 5-[4-(2-hydroxyethyl)phenyl]-1,2-oxazole-3-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2ccc(CCO)cc2)on1 |
| InChI | InChI=1S/C12H11NO4/c14-6-5-8-1-3-9(4-2-8)11-7-10(12(15)16)13-17-11/h1-4,7,14H,5-6H2,(H,15,16) |
| InChIKey | GDIMEYOFGVYTMJ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |