C18H15NO4 — CID 54846814
5-[4-(2-phenylethoxy)phenyl]-1,2-oxazole-3-carboxylic acid (PubChem CID 54846814) has the molecular formula C18H15NO4 and a molecular weight of 309.32 g/mol. Its IUPAC name is 5-[4-(2-phenylethoxy)phenyl]-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-[4-(2-phenylethoxy)phenyl]-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 54846814 |
| Molecular Formula | C18H15NO4 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 5-[4-(2-phenylethoxy)phenyl]-1,2-oxazole-3-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2ccc(OCCc3ccccc3)cc2)on1 |
| InChI | InChI=1S/C18H15NO4/c20-18(21)16-12-17(23-19-16)14-6-8-15(9-7-14)22-11-10-13-4-2-1-3-5-13/h1-9,12H,10-11H2,(H,20,21) |
| InChIKey | RKJVYFKRGWZKHW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |