C27H26N2O4 — CID 35133566
N-benzyl-N,5-bis(4-ethoxyphenyl)-1,2-oxazole-3-carboxamide (PubChem CID 35133566) has the molecular formula C27H26N2O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is N-benzyl-N,5-bis(4-ethoxyphenyl)-1,2-oxazole-3-carboxamide.
| Compound Name | N-benzyl-N,5-bis(4-ethoxyphenyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 35133566 |
| Molecular Formula | C27H26N2O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | N-benzyl-N,5-bis(4-ethoxyphenyl)-1,2-oxazole-3-carboxamide |
| SMILES | CCOc1ccc(-c2cc(C(=O)N(Cc3ccccc3)c3ccc(OCC)cc3)no2)cc1 |
| InChI | InChI=1S/C27H26N2O4/c1-3-31-23-14-10-21(11-15-23)26-18-25(28-33-26)27(30)29(19-20-8-6-5-7-9-20)22-12-16-24(17-13-22)32-4-2/h5-18H,3-4,19H2,1-2H3 |
| InChIKey | SHMPJAQUCCMFCY-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |