C11H9BrN2O2 — CID 63678754
2-bromo-N-[3-(1,3-oxazol-5-yl)phenyl]acetamide (PubChem CID 63678754) has the molecular formula C11H9BrN2O2 and a molecular weight of 281.11 g/mol. Its IUPAC name is 2-bromo-N-[3-(1,3-oxazol-5-yl)phenyl]acetamide.
| Compound Name | 2-bromo-N-[3-(1,3-oxazol-5-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 63678754 |
| Molecular Formula | C11H9BrN2O2 |
| Molecular Weight | 281.11 g/mol |
| Exact Mass | 279.98 |
| IUPAC Name | 2-bromo-N-[3-(1,3-oxazol-5-yl)phenyl]acetamide |
| SMILES | O=C(CBr)Nc1cccc(-c2cnco2)c1 |
| InChI | InChI=1S/C11H9BrN2O2/c12-5-11(15)14-9-3-1-2-8(4-9)10-6-13-7-16-10/h1-4,6-7H,5H2,(H,14,15) |
| InChIKey | BJZHWKLSWRJILT-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.11 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|