3-methyl-5-[3-(1,3-oxazol-5-yl)anilino]-5-oxopentanoic acid

C15H16N2O4 — CID 62965913

IUPAC3-methyl-5-[3-(1,3-oxazol-5-yl)anilino]-5-oxopentanoic acid
SMILESCC(CC(=O)O)CC(=O)Nc1cccc(-c2cnco2)c1
InChIInChI=1S/C15H16N2O4/c1-10(6-15(19)20)5-14(18)17-12-4-2-3-11(7-12)13-8-16-9-21-13/h2-4,7-10H,5-6H2,1H3,(H,17,18)(H,19,20)
InChIKeyMXRHBDVCWGDLQG-UHFFFAOYSA-N
MW288.30 g/mol
LogP2.78
Rot. Bonds6

About 3-methyl-5-[3-(1,3-oxazol-5-yl)anilino]-5-oxopentanoic acid

3-methyl-5-[3-(1,3-oxazol-5-yl)anilino]-5-oxopentanoic acid (PubChem CID 62965913) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is 3-methyl-5-[3-(1,3-oxazol-5-yl)anilino]-5-oxopentanoic acid.

Molecular Properties

Compound Name3-methyl-5-[3-(1,3-oxazol-5-yl)anilino]-5-oxopentanoic acid
PubChem CID62965913
Molecular FormulaC15H16N2O4
Molecular Weight288.30 g/mol
Exact Mass288.11
IUPAC Name3-methyl-5-[3-(1,3-oxazol-5-yl)anilino]-5-oxopentanoic acid
SMILESCC(CC(=O)O)CC(=O)Nc1cccc(-c2cnco2)c1
InChIInChI=1S/C15H16N2O4/c1-10(6-15(19)20)5-14(18)17-12-4-2-3-11(7-12)13-8-16-9-21-13/h2-4,7-10H,5-6H2,1H3,(H,17,18)(H,19,20)
InChIKeyMXRHBDVCWGDLQG-UHFFFAOYSA-N
XLogP2.78
TPSA92.43 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500288.30
LogP ≤ 52.78
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3-methyl-5-[3-(1,3-oxazol-5-yl)anilino]-5-oxopentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-methyl-5-[3-(1,3-oxazol-5-yl)anilino]-5-oxopentanoic acid?
The IUPAC name of 3-methyl-5-[3-(1,3-oxazol-5-yl)anilino]-5-oxopentanoic acid (CID 62965913) is 3-methyl-5-[3-(1,3-oxazol-5-yl)anilino]-5-oxopentanoic acid.
What is the SMILES notation for 3-methyl-5-[3-(1,3-oxazol-5-yl)anilino]-5-oxopentanoic acid?
The canonical SMILES for 3-methyl-5-[3-(1,3-oxazol-5-yl)anilino]-5-oxopentanoic acid is CC(CC(=O)O)CC(=O)Nc1cccc(-c2cnco2)c1.
What is the InChIKey of 3-methyl-5-[3-(1,3-oxazol-5-yl)anilino]-5-oxopentanoic acid?
The InChIKey is MXRHBDVCWGDLQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O4/c1-10(6-15(19)20)5-14(18)17-12-4-2-3-11(7-12)13-8-16-9-21-13/h2-4,7-10H,5-6H2,1H3,(H,17,18)(H,19,20).
What are the key properties of 3-methyl-5-[3-(1,3-oxazol-5-yl)anilino]-5-oxopentanoic acid?
3-methyl-5-[3-(1,3-oxazol-5-yl)anilino]-5-oxopentanoic acid has a molecular weight of 288.30 g/mol, XLogP of 2.78, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5-[3-(1,3-oxazol-5-yl)anilino]-5-oxopentanoic acid is sourced from PubChem (CID 62965913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).