C14H14N2O2 — CID 47353684
3-methyl-N-[3-(1,3-oxazol-5-yl)phenyl]but-2-enamide (PubChem CID 47353684) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is 3-methyl-N-[3-(1,3-oxazol-5-yl)phenyl]but-2-enamide.
| Compound Name | 3-methyl-N-[3-(1,3-oxazol-5-yl)phenyl]but-2-enamide |
|---|---|
| PubChem CID | 47353684 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 3-methyl-N-[3-(1,3-oxazol-5-yl)phenyl]but-2-enamide |
| SMILES | CC(C)=CC(=O)Nc1cccc(-c2cnco2)c1 |
| InChI | InChI=1S/C14H14N2O2/c1-10(2)6-14(17)16-12-5-3-4-11(7-12)13-8-15-9-18-13/h3-9H,1-2H3,(H,16,17) |
| InChIKey | IEIOZSSPZGZHAX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|