About 3-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-5-(2-methoxyphenyl)-4-methyl-2H-1,3-oxazol-2-amine
3-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-5-(2-methoxyphenyl)-4-methyl-2H-1,3-oxazol-2-amine (PubChem CID 67046578) has the molecular formula C21H21N3O4
and a molecular weight of 379.42 g/mol. Its IUPAC name is 3-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-5-(2-methoxyphenyl)-4-methyl-2H-1,3-oxazol-2-amine.
Molecular Properties
| Compound Name | 3-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-5-(2-methoxyphenyl)-4-methyl-2H-1,3-oxazol-2-amine |
| PubChem CID | 67046578 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 3-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-5-(2-methoxyphenyl)-4-methyl-2H-1,3-oxazol-2-amine |
| SMILES | COc1ccccc1C1=C(C)N(c2ccc(-c3cnco3)c(OC)c2)C(N)O1 |
| InChI | InChI=1S/C21H21N3O4/c1-13-20(16-6-4-5-7-17(16)25-2)28-21(22)24(13)14-8-9-15(18(10-14)26-3)19-11-23-12-27-19/h4-12,21H,22H2,1-3H3 |
| InChIKey | LJAQTAIFHKTABA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 82.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-5-(2-methoxyphenyl)-4-methyl-2H-1,3-oxazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-5-(2-methoxyphenyl)-4-methyl-2H-1,3-oxazol-2-amine?
The IUPAC name of 3-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-5-(2-methoxyphenyl)-4-methyl-2H-1,3-oxazol-2-amine (CID 67046578) is 3-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-5-(2-methoxyphenyl)-4-methyl-2H-1,3-oxazol-2-amine.
What is the SMILES notation for 3-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-5-(2-methoxyphenyl)-4-methyl-2H-1,3-oxazol-2-amine?
The canonical SMILES for 3-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-5-(2-methoxyphenyl)-4-methyl-2H-1,3-oxazol-2-amine is COc1ccccc1C1=C(C)N(c2ccc(-c3cnco3)c(OC)c2)C(N)O1.
What is the InChIKey of 3-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-5-(2-methoxyphenyl)-4-methyl-2H-1,3-oxazol-2-amine?
The InChIKey is LJAQTAIFHKTABA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N3O4/c1-13-20(16-6-4-5-7-17(16)25-2)28-21(22)24(13)14-8-9-15(18(10-14)26-3)19-11-23-12-27-19/h4-12,21H,22H2,1-3H3.
What are the key properties of 3-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-5-(2-methoxyphenyl)-4-methyl-2H-1,3-oxazol-2-amine?
3-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-5-(2-methoxyphenyl)-4-methyl-2H-1,3-oxazol-2-amine has a molecular weight of 379.42 g/mol, XLogP of 3.83, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-5-(2-methoxyphenyl)-4-methyl-2H-1,3-oxazol-2-amine is sourced from PubChem (CID 67046578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).