About methyl 2-[5-(2-amino-5-phenyl-2H-1,3-oxazol-3-yl)-2-(1,3-oxazol-5-yl)phenoxy]acetate
methyl 2-[5-(2-amino-5-phenyl-2H-1,3-oxazol-3-yl)-2-(1,3-oxazol-5-yl)phenoxy]acetate (PubChem CID 67046916) has the molecular formula C21H19N3O5
and a molecular weight of 393.40 g/mol. Its IUPAC name is methyl 2-[5-(2-amino-5-phenyl-2H-1,3-oxazol-3-yl)-2-(1,3-oxazol-5-yl)phenoxy]acetate.
Molecular Properties
| Compound Name | methyl 2-[5-(2-amino-5-phenyl-2H-1,3-oxazol-3-yl)-2-(1,3-oxazol-5-yl)phenoxy]acetate |
| PubChem CID | 67046916 |
| Molecular Formula | C21H19N3O5 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | methyl 2-[5-(2-amino-5-phenyl-2H-1,3-oxazol-3-yl)-2-(1,3-oxazol-5-yl)phenoxy]acetate |
| SMILES | COC(=O)COc1cc(N2C=C(c3ccccc3)OC2N)ccc1-c1cnco1 |
| InChI | InChI=1S/C21H19N3O5/c1-26-20(25)12-27-17-9-15(7-8-16(17)18-10-23-13-28-18)24-11-19(29-21(24)22)14-5-3-2-4-6-14/h2-11,13,21H,12,22H2,1H3 |
| InChIKey | QOHOLOQHYUHFLP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze methyl 2-[5-(2-amino-5-phenyl-2H-1,3-oxazol-3-yl)-2-(1,3-oxazol-5-yl)phenoxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[5-(2-amino-5-phenyl-2H-1,3-oxazol-3-yl)-2-(1,3-oxazol-5-yl)phenoxy]acetate?
The IUPAC name of methyl 2-[5-(2-amino-5-phenyl-2H-1,3-oxazol-3-yl)-2-(1,3-oxazol-5-yl)phenoxy]acetate (CID 67046916) is methyl 2-[5-(2-amino-5-phenyl-2H-1,3-oxazol-3-yl)-2-(1,3-oxazol-5-yl)phenoxy]acetate.
What is the SMILES notation for methyl 2-[5-(2-amino-5-phenyl-2H-1,3-oxazol-3-yl)-2-(1,3-oxazol-5-yl)phenoxy]acetate?
The canonical SMILES for methyl 2-[5-(2-amino-5-phenyl-2H-1,3-oxazol-3-yl)-2-(1,3-oxazol-5-yl)phenoxy]acetate is COC(=O)COc1cc(N2C=C(c3ccccc3)OC2N)ccc1-c1cnco1.
What is the InChIKey of methyl 2-[5-(2-amino-5-phenyl-2H-1,3-oxazol-3-yl)-2-(1,3-oxazol-5-yl)phenoxy]acetate?
The InChIKey is QOHOLOQHYUHFLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19N3O5/c1-26-20(25)12-27-17-9-15(7-8-16(17)18-10-23-13-28-18)24-11-19(29-21(24)22)14-5-3-2-4-6-14/h2-11,13,21H,12,22H2,1H3.
What are the key properties of methyl 2-[5-(2-amino-5-phenyl-2H-1,3-oxazol-3-yl)-2-(1,3-oxazol-5-yl)phenoxy]acetate?
methyl 2-[5-(2-amino-5-phenyl-2H-1,3-oxazol-3-yl)-2-(1,3-oxazol-5-yl)phenoxy]acetate has a molecular weight of 393.40 g/mol, XLogP of 2.97, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[5-(2-amino-5-phenyl-2H-1,3-oxazol-3-yl)-2-(1,3-oxazol-5-yl)phenoxy]acetate is sourced from PubChem (CID 67046916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).