C30H25Cl2NO4 — CID 4132325
3-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]-N-(4-phenylmethoxyphenyl)prop-2-enamide (PubChem CID 4132325) has the molecular formula C30H25Cl2NO4 and a molecular weight of 534.44 g/mol. Its IUPAC name is 3-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]-N-(4-phenylmethoxyphenyl)prop-2-enamide.
| Compound Name | 3-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]-N-(4-phenylmethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4132325 |
| Molecular Formula | C30H25Cl2NO4 |
| Molecular Weight | 534.44 g/mol |
| Exact Mass | 533.12 |
| IUPAC Name | 3-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]-N-(4-phenylmethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(C=CC(=O)Nc2ccc(OCc3ccccc3)cc2)ccc1OCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C30H25Cl2NO4/c1-35-29-18-21(10-16-28(29)37-20-25-26(31)8-5-9-27(25)32)11-17-30(34)33-23-12-14-24(15-13-23)36-19-22-6-3-2-4-7-22/h2-18H,19-20H2,1H3,(H,33,34) |
| InChIKey | ATCUURBNVWOJBH-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.44 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|