C22H20N4O6 — CID 25181995
N-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methyl]-N'-[4-methoxy-3-(1,3-oxazol-5-yl)phenyl]oxamide (PubChem CID 25181995) has the molecular formula C22H20N4O6 and a molecular weight of 436.42 g/mol. Its IUPAC name is N-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methyl]-N'-[4-methoxy-3-(1,3-oxazol-5-yl)phenyl]oxamide.
| Compound Name | N-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methyl]-N'-[4-methoxy-3-(1,3-oxazol-5-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 25181995 |
| Molecular Formula | C22H20N4O6 |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | N-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methyl]-N'-[4-methoxy-3-(1,3-oxazol-5-yl)phenyl]oxamide |
| SMILES | COc1ccc(NC(=O)C(=O)NCc2ccc(/C=C/C(=O)NO)cc2)cc1-c1cnco1 |
| InChI | InChI=1S/C22H20N4O6/c1-31-18-8-7-16(10-17(18)19-12-23-13-32-19)25-22(29)21(28)24-11-15-4-2-14(3-5-15)6-9-20(27)26-30/h2-10,12-13,30H,11H2,1H3,(H,24,28)(H,25,29)(H,26,27)/b9-6+ |
| InChIKey | UVKUPKPZIOEIDV-RMKNXTFCSA-N |
| XLogP | 2.12 |
| TPSA | 142.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|