C22H25N5O3S2 — CID 55492764
(E)-3-[4-(diethylsulfamoyl)phenyl]-N-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]prop-2-enamide (PubChem CID 55492764) has the molecular formula C22H25N5O3S2 and a molecular weight of 471.61 g/mol. Its IUPAC name is (E)-3-[4-(diethylsulfamoyl)phenyl]-N-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-[4-(diethylsulfamoyl)phenyl]-N-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55492764 |
| Molecular Formula | C22H25N5O3S2 |
| Molecular Weight | 471.61 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | (E)-3-[4-(diethylsulfamoyl)phenyl]-N-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]prop-2-enamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(/C=C/C(=O)Nc2ccc(Sc3nncn3C)cc2)cc1 |
| InChI | InChI=1S/C22H25N5O3S2/c1-4-27(5-2)32(29,30)20-13-6-17(7-14-20)8-15-21(28)24-18-9-11-19(12-10-18)31-22-25-23-16-26(22)3/h6-16H,4-5H2,1-3H3,(H,24,28)/b15-8+ |
| InChIKey | ZRFPYMAOOBMYLK-OVCLIPMQSA-N |
| XLogP | 3.65 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.61 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|